Products 515821-11-1
CAS 515821-11-1 is the registry number for SU10944. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
3-[5-methyl-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid (CAS 515821-11-1) is a chemical compound with the molecular formula C17H16N2O3 and a molecular weight of 296.32 g/mol. IUPAC name: 3-[5-methyl-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid. InChIKey: JTSHKHCXDTXFCS-LCYFTJDESA-N.
| Molecular formula | C17H16N2O3 |
|---|---|
| Molecular weight | 296.32 g/mol |
| IUPAC name | 3-[5-methyl-2-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]-1H-pyrrol-3-yl]propanoic acid |
| InChIKey | JTSHKHCXDTXFCS-LCYFTJDESA-N |
| SMILES | CC1=CC(=C(N1)/C=C\2/C3=CC=CC=C3NC2=O)CCC(=O)O |
Computed by PubChem (NCBI)