CAS 51583-97-2 appears in our catalog under these names: 3-hydroxy-1,3-bis(naphthalen-2-yl)prop-2-en-1-one, 97%, 1,3-Di(naphthalen-2-yl)propane-1,3-dione, 97%, Dinaphthoylmethane. Offered by: Fluorochem, Chemat Brand, Chemat. Available pack sizes: 100mg, 250mg, 1g, on request.
1,3-dinaphthalen-2-ylpropane-1,3-dione (CAS 51583-97-2) is a chemical compound with the molecular formula C23H16O2 and a molecular weight of 324.4 g/mol. IUPAC name: 1,3-dinaphthalen-2-ylpropane-1,3-dione. InChIKey: BSYFDFPTOXRGMP-UHFFFAOYSA-N.
| Molecular formula | C23H16O2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 1,3-dinaphthalen-2-ylpropane-1,3-dione |
| InChIKey | BSYFDFPTOXRGMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)CC(=O)C3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)