CAS 515845-18-8 is the registry number for Celecoxib Impurity 48. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-methylphenyl)-1-phenyl-3-(trifluoromethyl)pyrazole (CAS 515845-18-8) is a chemical compound with the molecular formula C17H13F3N2 and a molecular weight of 302.29 g/mol. IUPAC name: 5-(4-methylphenyl)-1-phenyl-3-(trifluoromethyl)pyrazole. InChIKey: UHIHPRCEHZQZCL-UHFFFAOYSA-N.
| Molecular formula | C17H13F3N2 |
|---|---|
| Molecular weight | 302.29 g/mol |
| IUPAC name | 5-(4-methylphenyl)-1-phenyl-3-(trifluoromethyl)pyrazole |
| InChIKey | UHIHPRCEHZQZCL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=NN2C3=CC=CC=C3)C(F)(F)F |
Computed by PubChem (NCBI)