CAS 51598-60-8 appears in our catalog under these names: Cimetropium bromide, 95%, Cimetropium Bromide, Cimetropium Bromide (DA–3177), Cimetropium (Bromide), 97.46%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 2mg, 25mg, 50mg, 1mg, 10mg.
[9-(cyclopropylmethyl)-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate bromide (CAS 51598-60-8) is a chemical compound with the molecular formula C21H28BrNO4 and a molecular weight of 438.4 g/mol. IUPAC name: [9-(cyclopropylmethyl)-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate bromide. InChIKey: WDURTRGFUGAJHA-BITHUKPRSA-M.
| Molecular formula | C21H28BrNO4 |
|---|---|
| Molecular weight | 438.4 g/mol |
| IUPAC name | [9-(cyclopropylmethyl)-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] (2S)-3-hydroxy-2-phenylpropanoate bromide |
| InChIKey | WDURTRGFUGAJHA-BITHUKPRSA-M |
| SMILES | C[N+]1(C2CC(CC1C3C2O3)OC(=O)[C@H](CO)C4=CC=CC=C4)CC5CC5.[Br-] |
Computed by PubChem (NCBI)