CAS 51657-41-1 is the registry number for 2-[(2-Amino-4-nitrophenyl)disulfanyl]-5-nitroaniline, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-[(2-amino-4-nitrophenyl)disulfanyl]-5-nitroaniline (CAS 51657-41-1) is a chemical compound with the molecular formula C12H10N4O4S2 and a molecular weight of 338.4 g/mol. IUPAC name: 2-[(2-amino-4-nitrophenyl)disulfanyl]-5-nitroaniline. InChIKey: IPFHDGFNMJCLQU-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O4S2 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | 2-[(2-amino-4-nitrophenyl)disulfanyl]-5-nitroaniline |
| InChIKey | IPFHDGFNMJCLQU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N)SSC2=C(C=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)