Products 51657-88-6
CAS 51657-88-6 is the registry number for 4-Methoxy-N-methylaniline-d3. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-methoxy-N-(trideuteriomethyl)aniline (CAS 51657-88-6) is a chemical compound with the molecular formula C8H11NO and a molecular weight of 140.20 g/mol. IUPAC name: 4-methoxy-N-(trideuteriomethyl)aniline. InChIKey: JFXDIXYFXDOZIT-FIBGUPNXSA-N.
| Molecular formula | C8H11NO |
|---|---|
| Molecular weight | 140.20 g/mol |
| IUPAC name | 4-methoxy-N-(trideuteriomethyl)aniline |
| InChIKey | JFXDIXYFXDOZIT-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)