CAS 51659-21-3 is the registry number for 2-benzoyl-3-phenylaziridine. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 2,5g.
Phenyl-(3-phenylaziridin-2-yl)methanone (CAS 51659-21-3) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: phenyl-(3-phenylaziridin-2-yl)methanone. InChIKey: SUHPZGRFOCEHTL-UHFFFAOYSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | phenyl-(3-phenylaziridin-2-yl)methanone |
| InChIKey | SUHPZGRFOCEHTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(N2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)