Products 51670-71-4
CAS 51670-71-4 is the registry number for 4-Bromo-2-chloronaphthalen-1-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-bromo-2-chloronaphthalen-1-amine (CAS 51670-71-4) is a chemical compound with the molecular formula C10H7BrClN and a molecular weight of 256.52 g/mol. IUPAC name: 4-bromo-2-chloronaphthalen-1-amine. InChIKey: SMGQPSINQDUPQY-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClN |
|---|---|
| Molecular weight | 256.52 g/mol |
| IUPAC name | 4-bromo-2-chloronaphthalen-1-amine |
| InChIKey | SMGQPSINQDUPQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2N)Cl)Br |
Computed by PubChem (NCBI)