CAS 51676-76-7 is the registry number for 2,4-Dichloro-3-methyl-1,5-dinitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2,4-dichloro-3-methyl-1,5-dinitrobenzene (CAS 51676-76-7) is a chemical compound with the molecular formula C7H4Cl2N2O4 and a molecular weight of 251.02 g/mol. IUPAC name: 2,4-dichloro-3-methyl-1,5-dinitrobenzene. InChIKey: JPOQYGXPWJDBLY-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O4 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | 2,4-dichloro-3-methyl-1,5-dinitrobenzene |
| InChIKey | JPOQYGXPWJDBLY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1Cl)[N+](=O)[O-])[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)