CAS 517-43-1 appears in our catalog under these names: Sennoside, 20%+,RG, 20%+,RG, Sennoside. Offered by: Chemat, MedChemExpress. Available pack sizes: 5g, 25g, 100g, 500g, 50 mg, 100 mg, 10 mg, 5 mg.
Sennoside is a diastereoisomeric mixture containing sennoside A and sennoside B that is used as a laxative and cathartic. Its components are found in senna (Senna alexandrina, also known as Cassia angustifolia), where sennoside A and sennoside B are present in equal amounts, and in rhubarbs (Rheum rhabarbarum), where sennoside A predominates. It has a role as a laxative and a cathartic. It contains a sennoside B and a sennoside A.
Source: ChEBI
| Molecular formula | C42H38O20 |
|---|---|
| Molecular weight | 862.7 g/mol |
| IUPAC name | 9-[2-carboxy-4-hydroxy-10-oxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracen-9-yl]-4-hydroxy-10-oxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracene-2-carboxylic acid |
| InChIKey | IPQVTOJGNYVQEO-JLDSCGAUSA-N |
| SMILES | C1=CC2=C(C(=C1)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C(=O)C4=C(C2C5C6=C(C(=CC=C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C(=O)C8=C5C=C(C=C8O)C(=O)O)C=C(C=C4O)C(=O)O |
Computed by PubChem (NCBI)