CAS 517-45-3 is the registry number for 9,9'-Dixanthylidene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
9-xanthen-9-ylidenexanthene (CAS 517-45-3) is a chemical compound with the molecular formula C26H16O2 and a molecular weight of 360.4 g/mol. IUPAC name: 9-xanthen-9-ylidenexanthene. InChIKey: SXXWAWNPJCEOGD-UHFFFAOYSA-N.
| Molecular formula | C26H16O2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 9-xanthen-9-ylidenexanthene |
| InChIKey | SXXWAWNPJCEOGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C4=CC=CC=C4OC5=CC=CC=C53)C6=CC=CC=C6O2 |
Computed by PubChem (NCBI)