CAS 51717-52-3 is the registry number for DA5. Offered by: TRC, Biosynth. Available pack sizes: 100mg.
N-[[4-(dimethylamino)phenyl]methyl]adamantan-1-amine;hydrochloride (CAS 51717-52-3) is a chemical compound with the molecular formula C19H29ClN2 and a molecular weight of 320.9 g/mol. IUPAC name: N-[[4-(dimethylamino)phenyl]methyl]adamantan-1-amine;hydrochloride. InChIKey: UIIKCMMJCJHIRI-UHFFFAOYSA-N.
| Molecular formula | C19H29ClN2 |
|---|---|
| Molecular weight | 320.9 g/mol |
| IUPAC name | N-[[4-(dimethylamino)phenyl]methyl]adamantan-1-amine;hydrochloride |
| InChIKey | UIIKCMMJCJHIRI-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)CNC23CC4CC(C2)CC(C4)C3.Cl |
Computed by PubChem (NCBI)