Products 51728-21-3

CAS 51728-21-3 is the registry number for Dibenzyl (methylenebis(4,1-phenylene))dicarbamate 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl N-[4-[[4-(phenylmethoxycarbonylamino)phenyl]methyl]phenyl]carbamate (CAS 51728-21-3) is a chemical compound with the molecular formula C29H26N2O4 and a molecular weight of 466.5 g/mol. IUPAC name: benzyl N-[4-[[4-(phenylmethoxycarbonylamino)phenyl]methyl]phenyl]carbamate. InChIKey: ULMJIAHHZHZRNF-UHFFFAOYSA-N.

Identity
Molecular formulaC29H26N2O4
Molecular weight466.5 g/mol
IUPAC namebenzyl N-[4-[[4-(phenylmethoxycarbonylamino)phenyl]methyl]phenyl]carbamate
InChIKeyULMJIAHHZHZRNF-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NC2=CC=C(C=C2)CC3=CC=C(C=C3)NC(=O)OCC4=CC=CC=C4

Computed by PubChem (NCBI)