CAS 51732-20-8 appears in our catalog under these names: Potassium Dodecanoate-d23, 98 atom % D, min 98% Chemical Purity, Dodecanoate-d23 (potassium). Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1mg, 5mg.
Potassium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosadeuteriododecanoate (CAS 51732-20-8) is a chemical compound with the molecular formula C12H23KO2 and a molecular weight of 261.55 g/mol. IUPAC name: potassium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosadeuteriododecanoate. InChIKey: HIDKSOTTZRMUML-LBOOQGLESA-M.
| Molecular formula | C12H23KO2 |
|---|---|
| Molecular weight | 261.55 g/mol |
| IUPAC name | potassium 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosadeuteriododecanoate |
| InChIKey | HIDKSOTTZRMUML-LBOOQGLESA-M |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)[O-].[K+] |
Computed by PubChem (NCBI)