CAS 5175-83-7 appears in our catalog under these names: Bismuth tribromophenate, 95%, Tris(2,4,6-Tribromophenoxy)-bismuthine, >95% (HPLC). Offered by: Combi-blocks, TRC. Available pack sizes: 10g, 5g, 1g, 100mg.
CAS 5175-83-7 identifies a chemical compound with the molecular formula C6H3BiBr3O and a molecular weight of 539.78 g/mol. InChIKey: ASNXTBLZRUQMFQ-UHFFFAOYSA-N.
| Molecular formula | C6H3BiBr3O |
|---|---|
| Molecular weight | 539.78 g/mol |
| InChIKey | ASNXTBLZRUQMFQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)Br.[Bi] |
Computed by PubChem (NCBI)