CAS 51751-16-7 is the registry number for Tetrathiafulvalene-d4, 98%. Offered by: Combi-blocks. Available pack sizes: 100mg.
4,5-dideuterio-2-(4,5-dideuterio-1,3-dithiol-2-ylidene)-1,3-dithiole (CAS 51751-16-7) is a chemical compound with the molecular formula C6H4S4 and a molecular weight of 208.4 g/mol. IUPAC name: 4,5-dideuterio-2-(4,5-dideuterio-1,3-dithiol-2-ylidene)-1,3-dithiole. InChIKey: FHCPAXDKURNIOZ-RHQRLBAQSA-N.
| Molecular formula | C6H4S4 |
|---|---|
| Molecular weight | 208.4 g/mol |
| IUPAC name | 4,5-dideuterio-2-(4,5-dideuterio-1,3-dithiol-2-ylidene)-1,3-dithiole |
| InChIKey | FHCPAXDKURNIOZ-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(SC(=C2SC(=C(S2)[2H])[2H])S1)[2H] |
Computed by PubChem (NCBI)