CAS 51762-04-0 appears in our catalog under these names: Cephalosporin C Sodium Salt, Cephalosporin C sodium salt, Cephalosporin C sodium salt, 97%, 97%, Cefazedone Sodium Salt Impurity 2. Offered by: Chemat Brand, GLPBio, Chemat. Available pack sizes: on request, 1g, 250mg, 5g.
Sodium (6R,7R)-3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (CAS 51762-04-0) is a chemical compound with the molecular formula C16H20N3NaO8S and a molecular weight of 437.4 g/mol. IUPAC name: sodium (6R,7R)-3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate. InChIKey: HZWLVUKHUSRPCG-BJIHTTGYSA-M.
| Molecular formula | C16H20N3NaO8S |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | sodium (6R,7R)-3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| InChIKey | HZWLVUKHUSRPCG-BJIHTTGYSA-M |
| SMILES | CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)CCCC(C(=O)O)N)SC1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)