CAS 51767-45-4 is the registry number for N-(3,5-Dichloro-4-hydroxyphenyl)benzenesulfonamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3,5-dichloro-4-hydroxyphenyl)benzenesulfonamide (CAS 51767-45-4) is a chemical compound with the molecular formula C12H9Cl2NO3S and a molecular weight of 318.2 g/mol. IUPAC name: N-(3,5-dichloro-4-hydroxyphenyl)benzenesulfonamide. InChIKey: KFPBEVFQCXRYIR-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO3S |
|---|---|
| Molecular weight | 318.2 g/mol |
| IUPAC name | N-(3,5-dichloro-4-hydroxyphenyl)benzenesulfonamide |
| InChIKey | KFPBEVFQCXRYIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C(=C2)Cl)O)Cl |
Computed by PubChem (NCBI)