CAS 518-85-4 appears in our catalog under these names: 2,3-Dihydro-1H-phenalen-1-one, 98%, 2,3-Dihydro-1H-phenalen-1-one. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 0,5g, 50mg, 500mg, 100mg, 250mg.
2,3-dihydrophenalen-1-one (CAS 518-85-4) is a chemical compound with the molecular formula C13H10O and a molecular weight of 182.22 g/mol. IUPAC name: 2,3-dihydrophenalen-1-one. InChIKey: NUCARPFILXBGFK-UHFFFAOYSA-N.
| Molecular formula | C13H10O |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 2,3-dihydrophenalen-1-one |
| InChIKey | NUCARPFILXBGFK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC=CC3=C2C1=CC=C3 |
Computed by PubChem (NCBI)