CAS 51800-25-0 is the registry number for 2,4-Dichloro-6-(dibenzo[b,d]thiophen-4-yl)-1,3,5-triazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-6-dibenzothiophen-4-yl-1,3,5-triazine (CAS 51800-25-0) is a chemical compound with the molecular formula C15H7Cl2N3S and a molecular weight of 332.2 g/mol. IUPAC name: 2,4-dichloro-6-dibenzothiophen-4-yl-1,3,5-triazine. InChIKey: MPYMPGZPRPFXDS-UHFFFAOYSA-N.
| Molecular formula | C15H7Cl2N3S |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | 2,4-dichloro-6-dibenzothiophen-4-yl-1,3,5-triazine |
| InChIKey | MPYMPGZPRPFXDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C(=CC=C3)C4=NC(=NC(=N4)Cl)Cl |
Computed by PubChem (NCBI)