CAS 518044-36-5 appears in our catalog under these names: Mal-peg4-t-butyl ester, 95%, Mal–PEG4–Boc, 1,1-Dimethylethyl 15-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-4,7,10,13-tetraoxapentadecanoate, 98%, 98%, Mal-PEG4-Boc, 99.93%, Mal-PEG4-Boc, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1g, 25mg, 50mg, 250mg, 500mg, 250 mg, 500 mg.
Tert-butyl 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 518044-36-5) is a chemical compound with the molecular formula C19H31NO8 and a molecular weight of 401.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: IYFQIVYGXSVHRQ-UHFFFAOYSA-N.
| Molecular formula | C19H31NO8 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | IYFQIVYGXSVHRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)