CAS 518044-41-2 appears in our catalog under these names: Mal-peg4-acid, 95%, Mal–PEG4–acid, Mal-PEG4-acid 97%, Mal-PEG4-acid, 97%, 97%, Mal-PEG4-acid, 99.00%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, 25mg, 5g, 50mg, 25 mg, 100 mg.
3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 518044-41-2) is a chemical compound with the molecular formula C15H23NO8 and a molecular weight of 345.34 g/mol. IUPAC name: 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: BTFZSOVKVDCKQD-UHFFFAOYSA-N.
| Molecular formula | C15H23NO8 |
|---|---|
| Molecular weight | 345.34 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | BTFZSOVKVDCKQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)