Products 518047-30-8

CAS 518047-30-8 is the registry number for 4,5-Dihydroxy-6-(methoxycarbonyl)pyrimidine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidine-2-carboxylic acid (CAS 518047-30-8) is a chemical compound with the molecular formula C7H6N2O6 and a molecular weight of 214.13 g/mol. IUPAC name: 5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidine-2-carboxylic acid. InChIKey: VWGOJNFHYLXMAC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2O6
Molecular weight214.13 g/mol
IUPAC name5-hydroxy-4-methoxycarbonyl-6-oxo-1H-pyrimidine-2-carboxylic acid
InChIKeyVWGOJNFHYLXMAC-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=O)NC(=N1)C(=O)O)O

Computed by PubChem (NCBI)