CAS 518058-51-0 is the registry number for 6-Naphthylpyridine-2-(2,6-diisopropyl)phenylimine. Offered by: TRC. Available pack sizes: 2,5g.
N-[2,6-di(propan-2-yl)phenyl]-1-(6-naphthalen-1-yl-2-pyridinyl)methanimine (CAS 518058-51-0) is a chemical compound with the molecular formula C28H28N2 and a molecular weight of 392.5 g/mol. IUPAC name: N-[2,6-di(propan-2-yl)phenyl]-1-(6-naphthalen-1-yl-2-pyridinyl)methanimine. InChIKey: QXRUWBDJASERLO-UHFFFAOYSA-N.
| Molecular formula | C28H28N2 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | N-[2,6-di(propan-2-yl)phenyl]-1-(6-naphthalen-1-yl-2-pyridinyl)methanimine |
| InChIKey | QXRUWBDJASERLO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)N=CC2=NC(=CC=C2)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)