CAS 5181-10-2 appears in our catalog under these names: 4,4'-Dichloro diphenyl sulfide, 98%, Bis(4-chlorophenyl)sulfane, 98%, 4,4'–DICHLORO DIPHENYL SULFIDE, Bis(4-chlorophenyl) Sulfide, >98.0%(GC), Bis(4-chlorophenyl)sulfane. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 5g, 100g, 1g, 250mg.
1-chloro-4-(4-chlorophenyl)sulfanylbenzene (CAS 5181-10-2) is a chemical compound with the molecular formula C12H8Cl2S and a molecular weight of 255.2 g/mol. IUPAC name: 1-chloro-4-(4-chlorophenyl)sulfanylbenzene. InChIKey: MJEPOVIWHVRBIT-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2S |
|---|---|
| Molecular weight | 255.2 g/mol |
| IUPAC name | 1-chloro-4-(4-chlorophenyl)sulfanylbenzene |
| InChIKey | MJEPOVIWHVRBIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1SC2=CC=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)