CAS 51812-80-7 is the registry number for Ceraphyl 60 (Technical Grade). Offered by: TRC. Available pack sizes: 1g.
2-hydroxyethyl-dimethyl-[3-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propyl]azanium chloride (CAS 51812-80-7) is a chemical compound with the molecular formula C13H29ClN2O7 and a molecular weight of 360.83 g/mol. IUPAC name: 2-hydroxyethyl-dimethyl-[3-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propyl]azanium chloride. InChIKey: FVEWVVDBRQZLSJ-QTWKXRMISA-N.
| Molecular formula | C13H29ClN2O7 |
|---|---|
| Molecular weight | 360.83 g/mol |
| IUPAC name | 2-hydroxyethyl-dimethyl-[3-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]propyl]azanium chloride |
| InChIKey | FVEWVVDBRQZLSJ-QTWKXRMISA-N |
| SMILES | C[N+](C)(CCCNC(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)CCO.[Cl-] |
Computed by PubChem (NCBI)