CAS 51820-24-7 is the registry number for 7-ANCB Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
Benzhydryl (7R)-3-hydroxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (CAS 51820-24-7) is a chemical compound with the molecular formula C28H26N2O5S and a molecular weight of 502.6 g/mol. IUPAC name: benzhydryl (7R)-3-hydroxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate. InChIKey: JSNDVKXNQUBARH-ANJXDYJNSA-N.
| Molecular formula | C28H26N2O5S |
|---|---|
| Molecular weight | 502.6 g/mol |
| IUPAC name | benzhydryl (7R)-3-hydroxy-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| InChIKey | JSNDVKXNQUBARH-ANJXDYJNSA-N |
| SMILES | C1C(C(N2C(S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)OC(C4=CC=CC=C4)C5=CC=CC=C5)O |
Computed by PubChem (NCBI)