CAS 51828-94-5 appears in our catalog under these names: 3-Methyl-2-oxobutyric acid calcium salt, 96%, Calcium alpha-Ketovaline, 3-Methyl-2-oxobutyric Acid Calcium Salt, >95% (HPLC), Calcium 3-methyl-2-oxobutanoate, 97%, 3–Methyl–2–oxobutyric acid calcium salt. Offered by: Combi-blocks, Chemat Brand, TRC, AmBeed, GLPBio. Available pack sizes: 100g, 10g, 5g, 25g, 1g, on request, 500mg, 250mg.
Calcium bis(3-methyl-2-oxobutanoate) (CAS 51828-94-5) is a chemical compound with the molecular formula C10H14CaO6 and a molecular weight of 270.29 g/mol. IUPAC name: calcium bis(3-methyl-2-oxobutanoate). InChIKey: IMZGMVJQWNJKCI-UHFFFAOYSA-L.
| Molecular formula | C10H14CaO6 |
|---|---|
| Molecular weight | 270.29 g/mol |
| IUPAC name | calcium bis(3-methyl-2-oxobutanoate) |
| InChIKey | IMZGMVJQWNJKCI-UHFFFAOYSA-L |
| SMILES | CC(C)C(=O)C(=O)[O-].CC(C)C(=O)C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)