CAS 5185-55-7 is the registry number for 2-Chloro-6-methyl-4-phenyl-quinazoline, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-chloro-6-methyl-4-phenylquinazoline (CAS 5185-55-7) is a chemical compound with the molecular formula C15H11ClN2 and a molecular weight of 254.71 g/mol. IUPAC name: 2-chloro-6-methyl-4-phenylquinazoline. InChIKey: ZHQKTJCMHUYFNT-UHFFFAOYSA-N.
| Molecular formula | C15H11ClN2 |
|---|---|
| Molecular weight | 254.71 g/mol |
| IUPAC name | 2-chloro-6-methyl-4-phenylquinazoline |
| InChIKey | ZHQKTJCMHUYFNT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N=C2C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)