Products 51863-81-1
CAS 51863-81-1 is the registry number for 1-(4-Bromophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
1-(4-bromophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one (CAS 51863-81-1) is a chemical compound with the molecular formula C16H13BrO2 and a molecular weight of 317.18 g/mol. IUPAC name: 1-(4-bromophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one. InChIKey: FTECEXAWFUIWJG-UHFFFAOYSA-N.
| Molecular formula | C16H13BrO2 |
|---|---|
| Molecular weight | 317.18 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3-(4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | FTECEXAWFUIWJG-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C=CC(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)