CAS 51865-79-3 appears in our catalog under these names: Methotrexate EP Impurity F, Methotrexate Impurity 6(EP-F), D-Amethopterin, 98+%, (R)-Methotrexate, >95% (HPLC), D-(-)-Amethopterin hydrate. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
(2R)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid (CAS 51865-79-3) is a chemical compound with the molecular formula C20H22N8O5 and a molecular weight of 454.4 g/mol. IUPAC name: (2R)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid. InChIKey: FBOZXECLQNJBKD-CYBMUJFWSA-N.
| Molecular formula | C20H22N8O5 |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | (2R)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid |
| InChIKey | FBOZXECLQNJBKD-CYBMUJFWSA-N |
| SMILES | CN(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)N[C@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)