CAS 51899-07-1 is the registry number for calcium,3–hydroxybutanoate. Offered by: GLPBio. Available pack sizes: 10mg.
Calcium bis(3-hydroxybutanoate) (CAS 51899-07-1) is a chemical compound with the molecular formula C8H14CaO6 and a molecular weight of 246.27 g/mol. IUPAC name: calcium bis(3-hydroxybutanoate). InChIKey: OXUQOKIBNYSTGF-UHFFFAOYSA-L.
| Molecular formula | C8H14CaO6 |
|---|---|
| Molecular weight | 246.27 g/mol |
| IUPAC name | calcium bis(3-hydroxybutanoate) |
| InChIKey | OXUQOKIBNYSTGF-UHFFFAOYSA-L |
| SMILES | CC(CC(=O)[O-])O.CC(CC(=O)[O-])O.[Ca+2] |
Computed by PubChem (NCBI)