CAS 519175-80-5 appears in our catalog under these names: N-Nitroso Lisinopril, N-Nitroso Lisinopril, >95% (HPLC). Offered by: Chemat Brand, TRC, Sigma-Aldrich. Available pack sizes: on request, 25mg, 50mg, 5mg.
(2S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-phenylpropyl]-nitrosoamino]hexanoyl]pyrrolidine-2-carboxylic acid (CAS 519175-80-5) is a chemical compound with the molecular formula C21H30N4O6 and a molecular weight of 434.5 g/mol. IUPAC name: (2S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-phenylpropyl]-nitrosoamino]hexanoyl]pyrrolidine-2-carboxylic acid. InChIKey: WLZGMQJZWKPZQR-BZSNNMDCSA-N.
| Molecular formula | C21H30N4O6 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | (2S)-1-[(2S)-6-amino-2-[[(1S)-1-carboxy-3-phenylpropyl]-nitrosoamino]hexanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | WLZGMQJZWKPZQR-BZSNNMDCSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)[C@H](CCCCN)N([C@@H](CCC2=CC=CC=C2)C(=O)O)N=O)C(=O)O |
Computed by PubChem (NCBI)