CAS 51920-94-6 appears in our catalog under these names: (+)-Hyalodendrin, Hyalodendrin. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 25mg, 1mg, 5mg, 10mg, Get quote.
(4S)-1-benzyl-4-(hydroxymethyl)-5,7-dimethyl-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione (CAS 51920-94-6) is a chemical compound with the molecular formula C14H16N2O3S2 and a molecular weight of 324.4 g/mol. IUPAC name: (4S)-1-benzyl-4-(hydroxymethyl)-5,7-dimethyl-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione. InChIKey: SJRIMIDQFZMJPZ-KZUDCZAMSA-N.
| Molecular formula | C14H16N2O3S2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (4S)-1-benzyl-4-(hydroxymethyl)-5,7-dimethyl-2,3-dithia-5,7-diazabicyclo[2.2.2]octane-6,8-dione |
| InChIKey | SJRIMIDQFZMJPZ-KZUDCZAMSA-N |
| SMILES | CN1C(=O)[C@]2(N(C(=O)C1(SS2)CC3=CC=CC=C3)C)CO |
Computed by PubChem (NCBI)