CAS 51932-77-5 is the registry number for 2,5-Diethyl-3,4-diphenylcyclopentadienone min. 95%. Offered by: Chemat Synthesis. Available pack sizes: 5g.
2,5-diethyl-3,4-diphenylcyclopenta-2,4-dien-1-one (CAS 51932-77-5) is a chemical compound with the molecular formula C21H20O and a molecular weight of 288.4 g/mol. IUPAC name: 2,5-diethyl-3,4-diphenylcyclopenta-2,4-dien-1-one. InChIKey: MTZCOHPDBKHNON-UHFFFAOYSA-N.
| Molecular formula | C21H20O |
|---|---|
| Molecular weight | 288.4 g/mol |
| IUPAC name | 2,5-diethyl-3,4-diphenylcyclopenta-2,4-dien-1-one |
| InChIKey | MTZCOHPDBKHNON-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C1=O)CC)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)