CAS 52023-48-0 appears in our catalog under these names: 4-Hydroxy-2-mercaptopteridine, 95%, 2-Mercaptopteridin-4-ol, 97%, 4-Hydroxy-2-mercaptopteridine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg.
2-sulfanylidene-1H-pteridin-4-one (CAS 52023-48-0) is a chemical compound with the molecular formula C6H4N4OS and a molecular weight of 180.19 g/mol. IUPAC name: 2-sulfanylidene-1H-pteridin-4-one. InChIKey: VSPCYUNOZPCHLL-UHFFFAOYSA-N.
| Molecular formula | C6H4N4OS |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | 2-sulfanylidene-1H-pteridin-4-one |
| InChIKey | VSPCYUNOZPCHLL-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C(=O)NC(=S)N2 |
Computed by PubChem (NCBI)