CAS 52026-22-9 is the registry number for 2,2'-Dibromo-5,5'-dinitrobiphenyl. Offered by: TRC. Available pack sizes: 500mg.
1-bromo-2-(2-bromo-5-nitrophenyl)-4-nitrobenzene (CAS 52026-22-9) is a chemical compound with the molecular formula C12H6Br2N2O4 and a molecular weight of 401.99 g/mol. IUPAC name: 1-bromo-2-(2-bromo-5-nitrophenyl)-4-nitrobenzene. InChIKey: ZIVFUJSGWQGGPE-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2N2O4 |
|---|---|
| Molecular weight | 401.99 g/mol |
| IUPAC name | 1-bromo-2-(2-bromo-5-nitrophenyl)-4-nitrobenzene |
| InChIKey | ZIVFUJSGWQGGPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C2=C(C=CC(=C2)[N+](=O)[O-])Br)Br |
Computed by PubChem (NCBI)