CAS 52033-74-6 appears in our catalog under these names: Phenylhydrazine sulfate, 95%, Phenylhydrazine Sulfate, >98.0%(T), Phenylhydrazine hemisulfate, 98%(HPLC),RG, 98%(HPLC),RG. Offered by: Combi-blocks, TCI, Chemat. Available pack sizes: 25g, 5g, 1g.
Phenylhydrazine;sulfuric acid (CAS 52033-74-6) is a chemical compound with the molecular formula C12H18N4O4S and a molecular weight of 314.36 g/mol. IUPAC name: phenylhydrazine;sulfuric acid. InChIKey: GSKCKIQJTWVQLR-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O4S |
|---|---|
| Molecular weight | 314.36 g/mol |
| IUPAC name | phenylhydrazine;sulfuric acid |
| InChIKey | GSKCKIQJTWVQLR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NN.C1=CC=C(C=C1)NN.OS(=O)(=O)O |
Computed by PubChem (NCBI)