CAS 521064-34-6 is the registry number for CT 32228. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-N-(4-bromophenyl)-6-(5-chloro-2-methylphenyl)-1,3,5-triazine-2,4-diamine (CAS 521064-34-6) is a chemical compound with the molecular formula C16H13BrClN5 and a molecular weight of 390.7 g/mol. IUPAC name: 2-N-(4-bromophenyl)-6-(5-chloro-2-methylphenyl)-1,3,5-triazine-2,4-diamine. InChIKey: NUPGPJBRKLLVNK-UHFFFAOYSA-N.
| Molecular formula | C16H13BrClN5 |
|---|---|
| Molecular weight | 390.7 g/mol |
| IUPAC name | 2-N-(4-bromophenyl)-6-(5-chloro-2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| InChIKey | NUPGPJBRKLLVNK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)C2=NC(=NC(=N2)NC3=CC=C(C=C3)Br)N |
Computed by PubChem (NCBI)