Products 52107-98-9

CAS 52107-98-9 appears in our catalog under these names: 3-Iodo-4-methylbenzoyl chloride, 98%, 3-Iodo-4-methylbenzoyl chloride, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3-iodo-4-methylbenzoyl chloride (CAS 52107-98-9) is a chemical compound with the molecular formula C8H6ClIO and a molecular weight of 280.49 g/mol. IUPAC name: 3-iodo-4-methylbenzoyl chloride. InChIKey: JCOQBCLTGOENLA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClIO
Molecular weight280.49 g/mol
IUPAC name3-iodo-4-methylbenzoyl chloride
InChIKeyJCOQBCLTGOENLA-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C(=O)Cl)I

Computed by PubChem (NCBI)