CAS 52123-30-5 appears in our catalog under these names: L-Lysyl-L-lysine dihydrochloride, L–Lysyl–L–lysine dihydrochloride, L-Lysyl-L-lysine 2HCl 95%, (S)-6-Amino-2-((S)-2,6-diaminohexanamido)hexanoic acid dihydrochloride, 95%, 95%, L-Lysyl-L-lysine (dihydrochloride), 98.18%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 1g, 250mg, 250 mg, 100 mg.
6-amino-2-(2,6-diaminohexanoylamino)hexanoic acid;dihydrochloride (CAS 52123-30-5) is a chemical compound with the molecular formula C12H28Cl2N4O3 and a molecular weight of 347.28 g/mol. IUPAC name: 6-amino-2-(2,6-diaminohexanoylamino)hexanoic acid;dihydrochloride. InChIKey: LXQFWEBCTJENGB-UHFFFAOYSA-N.
| Molecular formula | C12H28Cl2N4O3 |
|---|---|
| Molecular weight | 347.28 g/mol |
| IUPAC name | 6-amino-2-(2,6-diaminohexanoylamino)hexanoic acid;dihydrochloride |
| InChIKey | LXQFWEBCTJENGB-UHFFFAOYSA-N |
| SMILES | C(CCN)CC(C(=O)NC(CCCCN)C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)