CAS 521300-03-8 appears in our catalog under these names: 4-Amino-5-isopropyl-2h-pyrazole-3-formamide, 95%, 4-Amino-3-isopropyl-1H-pyrazole-5-carboxamide, 98%, 4-Amino-3-isopropyl-1H-pyrazole-5-carboxamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 50mg, 0,5g.
4-amino-5-propan-2-yl-1H-pyrazole-3-carboxamide (CAS 521300-03-8) is a chemical compound with the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. IUPAC name: 4-amino-5-propan-2-yl-1H-pyrazole-3-carboxamide. InChIKey: NTTYFNYUOSGCLO-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O |
|---|---|
| Molecular weight | 168.20 g/mol |
| IUPAC name | 4-amino-5-propan-2-yl-1H-pyrazole-3-carboxamide |
| InChIKey | NTTYFNYUOSGCLO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=NN1)C(=O)N)N |
Computed by PubChem (NCBI)