CAS 52157-91-2 is the registry number for Galosemide. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 100mg, 250mg.
N-[[4-[3-(trifluoromethyl)anilino]-3-pyridinyl]sulfonyl]propanamide (CAS 52157-91-2) is a chemical compound with the molecular formula C15H14F3N3O3S and a molecular weight of 373.4 g/mol. IUPAC name: N-[[4-[3-(trifluoromethyl)anilino]-3-pyridinyl]sulfonyl]propanamide. InChIKey: GNWHIAXZYUDAFX-UHFFFAOYSA-N.
| Molecular formula | C15H14F3N3O3S |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | N-[[4-[3-(trifluoromethyl)anilino]-3-pyridinyl]sulfonyl]propanamide |
| InChIKey | GNWHIAXZYUDAFX-UHFFFAOYSA-N |
| SMILES | CCC(=O)NS(=O)(=O)C1=C(C=CN=C1)NC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)