CAS 52168-00-0 is the registry number for Silane, trimethyl[(pentafluorophenyl)ethynyl]-, 90%(NMR), 90%(NMR). Offered by: Chemat. Available pack sizes: 250mg, 1g.
Trimethyl-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]silane (CAS 52168-00-0) is a chemical compound with the molecular formula C11H9F5Si and a molecular weight of 264.27 g/mol. IUPAC name: trimethyl-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]silane. InChIKey: OHIRKWPMCLVZHL-UHFFFAOYSA-N.
| Molecular formula | C11H9F5Si |
|---|---|
| Molecular weight | 264.27 g/mol |
| IUPAC name | trimethyl-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]silane |
| InChIKey | OHIRKWPMCLVZHL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)