CAS 52174-99-9 is the registry number for L-ascorbicacid2-sulfatedipotassiumsalt, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Dipotassium;[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-oxido-5-oxo-2H-furan-4-yl] sulfate (CAS 52174-99-9) is a chemical compound with the molecular formula C6H6K2O9S and a molecular weight of 332.37 g/mol. IUPAC name: dipotassium;[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-oxido-5-oxo-2H-furan-4-yl] sulfate. InChIKey: BXVMXUPHPZDIMH-YCWPWOODSA-L.
| Molecular formula | C6H6K2O9S |
|---|---|
| Molecular weight | 332.37 g/mol |
| IUPAC name | dipotassium;[(2R)-2-[(1S)-1,2-dihydroxyethyl]-3-oxido-5-oxo-2H-furan-4-yl] sulfate |
| InChIKey | BXVMXUPHPZDIMH-YCWPWOODSA-L |
| SMILES | C([C@@H]([C@@H]1C(=C(C(=O)O1)OS(=O)(=O)[O-])[O-])O)O.[K+].[K+] |
Computed by PubChem (NCBI)