CAS 52197-23-6 is the registry number for 2,3-Dicyano-5,6-diphenylpyrazine. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.
5,6-diphenylpyrazine-2,3-dicarbonitrile (CAS 52197-23-6) is a chemical compound with the molecular formula C18H10N4 and a molecular weight of 282.3 g/mol. IUPAC name: 5,6-diphenylpyrazine-2,3-dicarbonitrile. InChIKey: KHQNNRFYGOENPJ-UHFFFAOYSA-N.
| Molecular formula | C18H10N4 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | 5,6-diphenylpyrazine-2,3-dicarbonitrile |
| InChIKey | KHQNNRFYGOENPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C(N=C2C3=CC=CC=C3)C#N)C#N |
Computed by PubChem (NCBI)