Products 52209-77-5

CAS 52209-77-5 appears in our catalog under these names: 3,3-Dimethylcyclohexanecarboxylic acid, 98%, 3,3-Dimethylcyclohexane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 50mg, 0,5g.

3,3-dimethylcyclohexane-1-carboxylic acid (CAS 52209-77-5) is a chemical compound with the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. IUPAC name: 3,3-dimethylcyclohexane-1-carboxylic acid. InChIKey: JVTKAQYLRKDVOL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O2
Molecular weight156.22 g/mol
IUPAC name3,3-dimethylcyclohexane-1-carboxylic acid
InChIKeyJVTKAQYLRKDVOL-UHFFFAOYSA-N
SMILESCC1(CCCC(C1)C(=O)O)C

Computed by PubChem (NCBI)