CAS 52224-46-1 is the registry number for 1,3-Bis(4-benzoylphenoxy)propane. Offered by: TRC. Available pack sizes: 750mg.
[4-[3-(4-benzoylphenoxy)propoxy]phenyl]-phenylmethanone (CAS 52224-46-1) is a chemical compound with the molecular formula C29H24O4 and a molecular weight of 436.5 g/mol. IUPAC name: [4-[3-(4-benzoylphenoxy)propoxy]phenyl]-phenylmethanone. InChIKey: CHFLWNIERABBFW-UHFFFAOYSA-N.
| Molecular formula | C29H24O4 |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | [4-[3-(4-benzoylphenoxy)propoxy]phenyl]-phenylmethanone |
| InChIKey | CHFLWNIERABBFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)OCCCOC3=CC=C(C=C3)C(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)