CAS 522598-25-0 is the registry number for N-(5-(Tert-pentyl)-1,3,4-thiadiazol-2-yl)pyrazine-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[5-(2-methylbutan-2-yl)-1,3,4-thiadiazol-2-yl]pyrazine-2-carboxamide (CAS 522598-25-0) is a chemical compound with the molecular formula C12H15N5OS and a molecular weight of 277.35 g/mol. IUPAC name: N-[5-(2-methylbutan-2-yl)-1,3,4-thiadiazol-2-yl]pyrazine-2-carboxamide. InChIKey: DUWPAURULJGROA-UHFFFAOYSA-N.
| Molecular formula | C12H15N5OS |
|---|---|
| Molecular weight | 277.35 g/mol |
| IUPAC name | N-[5-(2-methylbutan-2-yl)-1,3,4-thiadiazol-2-yl]pyrazine-2-carboxamide |
| InChIKey | DUWPAURULJGROA-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=NN=C(S1)NC(=O)C2=NC=CN=C2 |
Computed by PubChem (NCBI)