CAS 522626-08-0 is the registry number for Casein kinase 1δ-IN-18. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-N-pyridin-4-yl-N'-thiophen-2-ylsulfonylbenzenecarboximidamide (CAS 522626-08-0) is a chemical compound with the molecular formula C16H12ClN3O2S2 and a molecular weight of 377.9 g/mol. IUPAC name: 2-chloro-N-pyridin-4-yl-N'-thiophen-2-ylsulfonylbenzenecarboximidamide. InChIKey: SXRSFAKKHPJJJS-UHFFFAOYSA-N.
| Molecular formula | C16H12ClN3O2S2 |
|---|---|
| Molecular weight | 377.9 g/mol |
| IUPAC name | 2-chloro-N-pyridin-4-yl-N'-thiophen-2-ylsulfonylbenzenecarboximidamide |
| InChIKey | SXRSFAKKHPJJJS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)/C(=N\S(=O)(=O)C2=CC=CS2)/NC3=CC=NC=C3)Cl |
Computed by PubChem (NCBI)